Machine Learning with Python
Machine Learning with Python
Based on this Cognitive Class Course
Labs
The Labs for the course are located in the Labs folder are from CognitiveClass and are licensed under MIT
Intro to ML
Machine learning is a field of computer science that gives computers the ability to learn without being explicitly progammed
Some popular techniques are:
- Regression for predicting continuous values
- Classification for predicting a class/category
- Clustering for finding structure of data and summarization
- Associations for finding items/events that co-occur
- Anomaly detection is used for finding abnormal/unusual cases
- Sequence mining is for predicting next values
- Dimension reduction for reducing the size of data
- Recommendation systems
We have a few different buzzwords
- AI
- Computer Vision
- Language processing
- Creativity
- Machine learning
- Field of AI
- Experience based
- Classification
- Clustering
- Neural Networks
- Deep Learning
- Specialized case of ML
- More automation than most ML
Python for Machine Learning
Python has many different libraries for machine learning such as
NumPy
SciPy
Matplotlib
Pandas
Scikit Learn
Supervised vs Unsupervised
Supervised learning involves us supervising a machine learning model. We do this by teaching the model with a labelled dataset
There are two types of supervised learning, namely Classification and Regression
Unsupervised learning is when the model works on its own to discover information about data using techniques such as Dimension Reduction, Density Estimation, Market Basket Analysis, and Clustering
- Supervised
- Classification
- Regression
- More evaluation methods
- Controlled environment
- Unsupervised
- Clustering
- Fewer evaluation methods
- Less controlled environment
Regression
Regression makes use of two different variables
- Dependent - Predictors
- Independent - Target
With Regression our values need to be continuous, but the values can be either continuous, discrete, or categorical
There are two types of regression:
- Simple Regression
- Simple Linear Regression
- Simple Non-Linear Regression
- Single
- Multiple Regression
- Multiple Linear Regression
- Multiple Non-Linear Regression
- Multiple
Regression is used when we have continuous data and is well suited to predicting continuous data
There are many regression algorithms such as
- Ordinal regression
- Poisson regression
- Fast forest quartile regression
- Linear, polynomial, lasso, stepwise, and ridge regression
- Bayesian linear regression
- Neural network regression
- Decision forest regression
- Boosted decision tree regression
- K nearest neighbors (KNN)
Each of which are better suited to some circumstances than to others
Simple Linear Regression
In SLR we have two variables, one dependent, and one independent. The target variable () can be either be continuous or categorical, but the predictor () must be continuous
To get a better idea of whether SLR is appropriate we can simply do a plot of vs and find the line which will be the best fit for the data
The line is represented by the following equation
The aim of SLE is to adjust the values to minimize the residual error in our data and find the best fit
Estimating Parameters
We have two options to estimate our parameters, given an SLR problem
Estimate and using the following equations
We can use these values to make predictions with the equation
Pros
- Fast
- Easy to Understand
- No tuning needed
Lab
Import Necessary Libraries
%reset -f
import pandas as pd
import matplotlib.pyplot as plt
import pandas as pd
import pylab as pl
import numpy as np
%matplotlib inlineImport Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/FuelConsumptionCo2.csv')
df.head()| MODELYEAR | MAKE | MODEL | VEHICLECLASS | ENGINESIZE | CYLINDERS | TRANSMISSION | FUELTYPE | FUELCONSUMPTION_CITY | FUELCONSUMPTION_HWY | FUELCONSUMPTION_COMB | FUELCONSUMPTION_COMB_MPG | CO2EMISSIONS | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 2014 | ACURA | ILX | COMPACT | 2.0 | 4 | AS5 | Z | 9.9 | 6.7 | 8.5 | 33 | 196 |
| 1 | 2014 | ACURA | ILX | COMPACT | 2.4 | 4 | M6 | Z | 11.2 | 7.7 | 9.6 | 29 | 221 |
| 2 | 2014 | ACURA | ILX HYBRID | COMPACT | 1.5 | 4 | AV7 | Z | 6.0 | 5.8 | 5.9 | 48 | 136 |
| 3 | 2014 | ACURA | MDX 4WD | SUV - SMALL | 3.5 | 6 | AS6 | Z | 12.7 | 9.1 | 11.1 | 25 | 255 |
| 4 | 2014 | ACURA | RDX AWD | SUV - SMALL | 3.5 | 6 | AS6 | Z | 12.1 | 8.7 | 10.6 | 27 | 244 |
Data Exploration
df.describe()| MODELYEAR | ENGINESIZE | CYLINDERS | FUELCONSUMPTION_CITY | FUELCONSUMPTION_HWY | FUELCONSUMPTION_COMB | FUELCONSUMPTION_COMB_MPG | CO2EMISSIONS | |
|---|---|---|---|---|---|---|---|---|
| count | 1067.0 | 1067.000000 | 1067.000000 | 1067.000000 | 1067.000000 | 1067.000000 | 1067.000000 | 1067.000000 |
| mean | 2014.0 | 3.346298 | 5.794752 | 13.296532 | 9.474602 | 11.580881 | 26.441425 | 256.228679 |
| std | 0.0 | 1.415895 | 1.797447 | 4.101253 | 2.794510 | 3.485595 | 7.468702 | 63.372304 |
| min | 2014.0 | 1.000000 | 3.000000 | 4.600000 | 4.900000 | 4.700000 | 11.000000 | 108.000000 |
| 25% | 2014.0 | 2.000000 | 4.000000 | 10.250000 | 7.500000 | 9.000000 | 21.000000 | 207.000000 |
| 50% | 2014.0 | 3.400000 | 6.000000 | 12.600000 | 8.800000 | 10.900000 | 26.000000 | 251.000000 |
| 75% | 2014.0 | 4.300000 | 8.000000 | 15.550000 | 10.850000 | 13.350000 | 31.000000 | 294.000000 |
| max | 2014.0 | 8.400000 | 12.000000 | 30.200000 | 20.500000 | 25.800000 | 60.000000 | 488.000000 |
cdf = df[['ENGINESIZE','CYLINDERS','FUELCONSUMPTION_COMB','CO2EMISSIONS']]
cdf.head(10)| ENGINESIZE | CYLINDERS | FUELCONSUMPTION_COMB | CO2EMISSIONS | |
|---|---|---|---|---|
| 0 | 2.0 | 4 | 8.5 | 196 |
| 1 | 2.4 | 4 | 9.6 | 221 |
| 2 | 1.5 | 4 | 5.9 | 136 |
| 3 | 3.5 | 6 | 11.1 | 255 |
| 4 | 3.5 | 6 | 10.6 | 244 |
| 5 | 3.5 | 6 | 10.0 | 230 |
| 6 | 3.5 | 6 | 10.1 | 232 |
| 7 | 3.7 | 6 | 11.1 | 255 |
| 8 | 3.7 | 6 | 11.6 | 267 |
| 9 | 2.4 | 4 | 9.2 | 212 |
viz = cdf[['CYLINDERS','ENGINESIZE','CO2EMISSIONS','FUELCONSUMPTION_COMB']]
viz.hist()
plt.show()plt.title('CO2 Emission vs Fuel Consumption')
plt.scatter(cdf.FUELCONSUMPTION_COMB, cdf.CO2EMISSIONS, color='blue')
plt.xlabel("FUELCONSUMPTION_COMB")
plt.ylabel("Emission")
plt.show()plt.title('CO2 Emission vs Engine Size')
plt.scatter(cdf.ENGINESIZE, cdf.CO2EMISSIONS, color='blue')
plt.xlabel("Engine size")
plt.ylabel("Emission")
plt.show()plt.title('CO2 Emission vs Cylinders')
plt.scatter(cdf.CYLINDERS, cdf.CO2EMISSIONS, color='blue')
plt.xlabel("Cylinders")
plt.ylabel("Emission")
plt.show()Test-Train Split
We need to split our data into a test set and a train set
tt_mask = np.random.rand(len(df)) < 0.8
train = cdf[tt_mask].reset_index()
test = cdf[~tt_mask].reset_index()Simple Regression Model
We can look at the distribution of the Engine Size in our training and test set respectively as follows
plt.title('CO2 Emissions vs Engine Size for Test and Train Data')
plt.scatter(train.ENGINESIZE, train.CO2EMISSIONS,color='blue',label='train')
plt.scatter(test.ENGINESIZE, test.CO2EMISSIONS,color='red',label='test')
plt.xlabel("Engine size")
plt.ylabel("Emission")
plt.legend()
plt.show()Modeling
from sklearn import linear_modellin_reg = linear_model.LinearRegression()
train_x = train[['ENGINESIZE']]
train_y = train[['CO2EMISSIONS']]
test_x = test[['ENGINESIZE']]
test_y = test[['CO2EMISSIONS']]lin_reg.fit(train_x, train_y)LinearRegression(copy_X=True, fit_intercept=True, n_jobs=1, normalize=False)
'Coefficients: ' + str(lin_reg.coef_) + ' Intercept: ' + str(lin_reg.intercept_)'Coefficients: [[ 39.30964622]] Intercept: [ 124.8710344]'
We can plot the line on our data to see the fit
plt.title('CO2 Emissions vs Engine Size, Training and Fit')
plt.scatter(train.ENGINESIZE, train.CO2EMISSIONS,color='blue',label='train')
plt.plot(train_x, lin_reg.coef_[0,0]*train_x + lin_reg.intercept_[0],color='red',label='regression')
plt.xlabel("Engine size")
plt.ylabel("Emission")
plt.legend()
plt.show()Model Evaluation
Import Packages
from sklearn.metrics import r2_scorePredict the CO2 Emissions
predicted_y = lin_reg.predict(test_x)Display Results
results = pd.DataFrame()
results[['ENGINESIZE']] = test_x
results[['ACTUALCO2']] = test_y
results[['PREDICTEDCO2']] = pd.DataFrame(predicted_y)
results[['ERROR']] = pd.DataFrame(np.abs(predicted_y - test_y))
results[['SQUAREDERROR']] = pd.DataFrame((predicted_y - test_y)**2)
results.head()| ENGINESIZE | ACTUALCO2 | PREDICTEDCO2 | ERROR | SQUAREDERROR | |
|---|---|---|---|---|---|
| 0 | 5.9 | 359 | 356.797947 | 2.202053 | 4.849037 |
| 1 | 2.0 | 230 | 203.490327 | 26.509673 | 702.762771 |
| 2 | 2.0 | 230 | 203.490327 | 26.509673 | 702.762771 |
| 3 | 2.0 | 214 | 203.490327 | 10.509673 | 110.453230 |
| 4 | 5.2 | 409 | 329.281195 | 79.718805 | 6355.087912 |
Model Evaluation
MAE = np.mean(results[['ERROR']])
MSE = np.mean(results[['SQUAREDERROR']])
R2 = r2_score(test_y, predicted_y)
print("Mean absolute error: %.2f" % MAE)
print("Residual sum of squares (MSE): %.2f" % MSE)
print("R2-score: %.2f" % R2)Mean absolute error: 22.83 Residual sum of squares (MSE): 826.28 R2-score: 0.78
Multiple Linear Regression
In reality multiple independent variables will define a specific target. MLR is simply an extension on the SLR Model
MLR is useful for solving problems such as
- Define the impact of independent variables on effectiveness of prediction
- Predicting the impact of change in a specific variable
MLR makes use of multiple predictors to predict the target value, and is generally of the form
is a vector of coefficients which are multiplied by , these are called the parameters or weight vectors, and is the feature set, the idea with MLR is to predict the best-fit hyperplane for our data
Estimating Parameters
We have a few ways to estimate the best parameters, such as
- Ordinary Least Squares
- Linear algebra
- Not suited to large datasets
- Gradient Descent
- Good for large datasets
- Other methods are available to do this as well
How Many Variables?
Making use of more variables will generally increase the accuracy of the model, howevre using too many variables without good justification can lead to us overfitting the model
We can make use of categorical variables if we convert them to numerric values
MLR assumes that we have a linear relationship between the dependent and independent variables
Model Evaluation
We have to perform regression evaluation when building a model
Train/Test Joint
We make use of our data to train our model, and then compare the predicted values to the actual values of our model
The error of the model is the average of the actual and predicted values for the model
This approach has a high training accuracy, but a lower out-of-sample accuracy
Aiming for a very high training accuracy can lead to overfitting to the training data resulting in poor out-of-sample data
Train/Test Split
We split our data into a portion for testing and a portion for training, these two sets are mutually exclusive and allow us to get a good idea of what our out-of-sample accuracy will be
Generally we would train our data with the testing data afterwards in order to increase our accuracy
K-Fold Cross-Validation
This makes use of us splitting the dataset into different pieces, and using every combination of test/train datasets in order to get a more aggregated fit
Evaluation Metrics
Evaluation metrics are used to evaluate the performance of a model, metrics provide insight into areas of the model that require attention
Errors
In the context of regression, error is the difference between the data points and the valuedetermined by the model
Some of the main error equations are defined below
Fit
helps us see how closely our data is represented by a specific regression line, and is defined as
Or
A higher represents a better fit
Non-Linear Regression
Not all data can be predicted using a linear regression line, we have many diferent regression lines to fit more complex data
Polynomial Regression
Polynomial Regression is a method with which we can fit a polynomial to our data, it is still possible for us to define a polynomial regression by transforming it into a multi-variable linear regression problem as follows
Given the polynomial
We can create new variables which represent the different powers of our initial variable
Therefore resulting in the following linear equation
Other Non-Linear Regression
Non-Linear Regression can be of many forms as well, including any other mathematical relationships that we can define
For more complex NLR problems it can be difficult to evaluate the parameters for the equation
Lab
There are many different model types and equations shown in the Lab Notebook aside from what I have here
Import the Data
Using China's GDP data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/china_gdp.csv')
df.head()| Year | Value | |
|---|---|---|
| 0 | 1960 | 5.918412e+10 |
| 1 | 1961 | 4.955705e+10 |
| 2 | 1962 | 4.668518e+10 |
| 3 | 1963 | 5.009730e+10 |
| 4 | 1964 | 5.906225e+10 |
x_data, y_data = (df[['Year']], df[['Value']])Plotting the Data
plt.title('China\'s GDP by Year')
plt.plot(x_data, y_data, 'o')
plt.ylabel('GDP')
plt.xlabel('Year')
plt.show()Defining a Fit
Next we can try to approximate a curve that we think will fit the data we have, we can use a sigmoid, as defined below
: Controls the curve's steepness,
: Slides the curve on the x-axis.
def sigmoid(x, b_1, b_2):
y = 1 / (1 + np.exp(-b_1*(x-b_2)))
return yThe above function can be seen to be
X = np.arange(-5.0, 5.0, 0.1)
Y = sigmoid(X, 1, 1)
plt.title('Sigmoid')
plt.plot(X,Y)
plt.ylabel('Dependent Variable')
plt.xlabel('Indepdendent Variable')
plt.show()Next let's try to fit this to the data with some example values
b_1 = 0.10
b_2 = 1990.0
#logistic function
y_pred = sigmoid(x_data, b_1 , b_2)
#plot initial prediction against datapoints
plt.title('Approximating NLR with Sigmoid')
plt.plot(x_data, y_pred*15000000000000.)
plt.plot(x_data, y_data, 'ro')
plt.show()Data Normalization
Let's normalize our data so that we don't need to multiply by crazy numbers as before
# for some reason this seems to be the only way the conversion
# from a dataframe works as desired
# the normalization from the labs are as such:
# xdata =x_data/max(x_data)
# ydata =y_data/max(y_data)
x_norm = (np.array(x_data)/max(np.array(x_data))).transpose()[0]
y_norm = (np.array(y_data)/max(np.array(y_data))).transpose()[0]Finding the Best Fit
Next we can import curve_fit to help us fit the the curve to our data
from scipy.optimize import curve_fitpopt, pcov = curve_fit(sigmoid, x_norm, y_norm)
print(" beta_1 = %f, beta_2 = %f" % (popt[0], popt[1]))
print(popt)
print(pcov)beta_1 = 690.453017, beta_2 = 0.997207 [ 690.45301712 0.99720713] [[ 1.52273887e+03 -2.88115957e-04] [ -2.88115957e-04 7.25956452e-09]]
And we can plot the result as follows
x = np.linspace(1960, 2015, 55)
x = x/max(x)
y = sigmoid(x, *popt)
plt.title('Sigmoid Fit of Data')
plt.plot(x_norm, y_norm, 'ro', label='data')
plt.plot(x,y, linewidth=3.0, label='fit')
plt.legend()
plt.ylabel('GDP')
plt.xlabel('Year')
plt.show()Model Accuracy
from sklearn.metrics import r2_score
# split data into train/test
mask = np.random.rand(len(df)) < 0.8
train_x = x_norm[mask]
test_x = x_norm[~mask]
train_y = y_norm[mask]
test_y = y_norm[~mask]
# build the model using train set
popt, pcov = curve_fit(sigmoid, train_x, train_y)
# predict using test set
y_hat = sigmoid(test_x, *popt)
# evaluation
print("Mean absolute error: %.2f" % np.mean(np.absolute(y_hat - test_y)))
print("Residual sum of squares (MSE): %.2f" % np.mean((y_hat - test_y) ** 2))
print("R2-score: %.2f" % r2_score(y_hat , test_y) )Mean absolute error: 0.03 Residual sum of squares (MSE): 0.00 R2-score: 0.53
Classification
Classification is a supervised learning approach which is a means of splitting data into discrete classes
The target atribute is a categorical value with discrete values
Classification will determine the class label for a specific test case
Binary as well as multi-class classification methods are available
Learning Algorithms
Many learning algorithms are available for classification such as
- Decision trees
- Naive Bayes
- KNN
- Logistic Regression
- Neural Networks
- SVM
Evaluation Metrics
We have a few different evaluation metrics for classification
Jaccard Index
We simply measure which fraction of our predicted values intersect with the actual values
F1 Score
This is a measure which makes use of a confusion matrix and compares the predictions vs actual values for each class
In the count of binary classification this will give us our True Positives, False Positives, True Negatives and False Negatives
We can define some metrics for each class with the following
F1 varies between 0 and 1, with 1 being the best
The accuracy for a classifier is the average accuracy of each of its classes
Log Loss
The log loss is the performance of a classifier where the predicted output is a probability between 1 and 0
Better classifiers have a log loss closer to zero
K-Nearest Neighbor
KNN is a method of determining class based on the training datapoints that sit near our test datapoint based on the fact that closer datapoints are more important than those further away in predicting a specific value
Algorithm
- Pick a value for K
- Calculate distance of unknown case from known cases
- Select k observations
- Predict the value based on the most common observaton value
We can make use of euclidean distance to calculate the distance between our continuous values, and a voting system for discrete data
Using a low K value can lead to overfitting, and using a very high value can lead to us underfitting
In order to find the optimal K value we do multiple tests by continuously increasing our K value and measuring the accuracy for that K value
Furthermore KNN can also be used to predict continuous values (regression) by simply having a target variable and predictors that are continuous
Lab
Import Libraries
import itertools
import matplotlib.pyplot as plt
from matplotlib.ticker import NullFormatter
import matplotlib.ticker as ticker
from sklearn import preprocessingImport Data
The dataset being used is one in which demographic data is used to define a customer service group, these being as follows
| Value | Category |
|---|---|
| 1 | Basic Service |
| 2 | E-Service |
| 3 | Plus Service |
| 4 | Total Service |
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/teleCust1000t.csv')df.head()| region | tenure | age | marital | address | income | ed | employ | retire | gender | reside | custcat | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 2 | 13 | 44 | 1 | 9 | 64.0 | 4 | 5 | 0.0 | 0 | 2 | 1 |
| 1 | 3 | 11 | 33 | 1 | 7 | 136.0 | 5 | 5 | 0.0 | 0 | 6 | 4 |
| 2 | 3 | 68 | 52 | 1 | 24 | 116.0 | 1 | 29 | 0.0 | 1 | 2 | 3 |
| 3 | 2 | 33 | 33 | 0 | 12 | 33.0 | 2 | 0 | 0.0 | 1 | 1 | 1 |
| 4 | 2 | 23 | 30 | 1 | 9 | 30.0 | 1 | 2 | 0.0 | 0 | 4 | 3 |
Data Visualization and Analysis
We can look at the number of customers in each class
df.custcat.value_counts()3 281 1 266 4 236 2 217 Name: custcat, dtype: int64
df.hist()
plt.show()We can take a closer look at income with
df.income.hist(bins=50)
plt.title('Income of Customers')
plt.xlabel('Frequency')
plt.ylabel('Income')
plt.show()Features
To use sklearn we need to convert our data into an array as follows
df.columnsIndex(['region', 'tenure', 'age', 'marital', 'address', 'income', 'ed',
'employ', 'retire', 'gender', 'reside', 'custcat'],
dtype='object')# X = df.loc[:, 'region':'reside'].values
# Y = df.loc[:,'custcat'].values
X = df.loc[:, 'region':'reside']
Y = df.loc[:,'custcat']X.head()| region | tenure | age | marital | address | income | ed | employ | retire | gender | reside | |
|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 2 | 13 | 44 | 1 | 9 | 64.0 | 4 | 5 | 0.0 | 0 | 2 |
| 1 | 3 | 11 | 33 | 1 | 7 | 136.0 | 5 | 5 | 0.0 | 0 | 6 |
| 2 | 3 | 68 | 52 | 1 | 24 | 116.0 | 1 | 29 | 0.0 | 1 | 2 |
| 3 | 2 | 33 | 33 | 0 | 12 | 33.0 | 2 | 0 | 0.0 | 1 | 1 |
| 4 | 2 | 23 | 30 | 1 | 9 | 30.0 | 1 | 2 | 0.0 | 0 | 4 |
Y.head()0 1 1 4 2 3 3 1 4 3 Name: custcat, dtype: int64
Normalize Data
For alogrithms like KNN which are distance based it is useful to normalize the data to have a zero mean and unit variance, we can do this using the sklearn.preprocessing package
X = preprocessing.StandardScaler().fit(X).transform(X.astype(float))
print(X[0:5])[[-0.02696767 -1.055125 0.18450456 1.0100505 -0.25303431 -0.12650641 1.0877526 -0.5941226 -0.22207644 -1.03459817 -0.23065004] [ 1.19883553 -1.14880563 -0.69181243 1.0100505 -0.4514148 0.54644972 1.9062271 -0.5941226 -0.22207644 -1.03459817 2.55666158] [ 1.19883553 1.52109247 0.82182601 1.0100505 1.23481934 0.35951747 -1.36767088 1.78752803 -0.22207644 0.96655883 -0.23065004] [-0.02696767 -0.11831864 -0.69181243 -0.9900495 0.04453642 -0.41625141 -0.54919639 -1.09029981 -0.22207644 0.96655883 -0.92747794] [-0.02696767 -0.58672182 -0.93080797 1.0100505 -0.25303431 -0.44429125 -1.36767088 -0.89182893 -0.22207644 -1.03459817 1.16300577]]
Test/Train Split
Next we can split our model into a test and train set using sklearn.model_selection.train_test_split()
from sklearn.model_selection import train_test_splitran = 4
X_train, X_test, Y_train, Y_test = train_test_split(X,Y,test_size=0.2,random_state=ran)print('Train: ', X_train.shape, Y_train.shape)
print('Test: ', X_test.shape, Y_test.shape)Train: (800, 11) (800,) Test: (200, 11) (200,)
Classification
We can then make use of the KNN classifier on our data
from sklearn.neighbors import KNeighborsClassifier as knn_classifierWe will use an intial value of 4 for k, but will later evaluate different k values
k = 4knn = knn_classifier(n_neighbors=k)
knn.fit(X_train, Y_train)KNeighborsClassifier(algorithm='auto', leaf_size=30, metric='minkowski',
metric_params=None, n_jobs=1, n_neighbors=4, p=2,
weights='uniform')Y_hat = knn.predict(X_test)
print(Y_hat[0:5])[1 1 3 2 4]
Model Evaluation
from sklearn import metrics
print("Train set Accuracy: ", metrics.accuracy_score(Y_train, knn.predict(X_train)))
print("Test set Accuracy: ", metrics.accuracy_score(Y_test, Y_hat))Train set Accuracy: 0.5475 Test set Accuracy: 0.32
Other K Values
We can do this for additional K values to look at how the accuracy is affected
k_max = 100
mean_acc = np.zeros((k_max))
std_acc = np.zeros((k_max))
ConfustionMx = [];
for n in range(1,k_max + 1):
#Train Model and Predict
knn = knn_classifier(n_neighbors = n).fit(X_train,Y_train)
Y_hat = knn.predict(X_test)
mean_acc[n-1] = metrics.accuracy_score(Y_test, Y_hat)
std_acc[n-1] = np.std(Y_hat == Y_test)/np.sqrt(Y_hat.shape[0])
print(mean_acc)[ 0.3 0.29 0.315 0.32 0.315 0.31 0.335 0.325 0.34 0.33 0.315 0.34 0.33 0.315 0.34 0.36 0.355 0.35 0.345 0.335 0.35 0.36 0.37 0.365 0.365 0.365 0.35 0.36 0.38 0.385 0.395 0.395 0.38 0.37 0.365 0.385 0.395 0.41 0.395 0.395 0.395 0.38 0.39 0.375 0.365 0.38 0.375 0.375 0.365 0.36 0.36 0.365 0.37 0.38 0.37 0.37 0.37 0.36 0.35 0.36 0.355 0.36 0.36 0.36 0.34 0.34 0.345 0.35 0.35 0.355 0.365 0.355 0.355 0.365 0.37 0.37 0.37 0.35 0.35 0.35 0.35 0.36 0.355 0.33 0.32 0.345 0.345 0.345 0.335 0.345 0.355 0.345 0.345 0.34 0.34 0.335 0.345 0.325 0.315 0.31 ]
plt.title('Accuracy vs K')
plt.plot(range(1,k_max + 1),mean_acc,'g')
plt.fill_between(range(1,k_max + 1),mean_acc - 1 * std_acc,mean_acc + 1 * std_acc, alpha=0.10)
plt.legend(('Accuracy ', '+/- 3xstd'))
plt.ylabel('Accuracy')
plt.xlabel('Number of Neighbors (K)')
plt.tight_layout()
plt.show()The maximum accuracy can be found to be
print('Max Accuracy: {}, K={}'.format(max(mean_acc),mean_acc.argmax() + 1))Max Accuracy: 0.41, K=38
Test Sample
It can be noted that the accuracy and optimal value varies based on the random_state parameter in the train_test_split function used when doing the test/train split
Retrain with All Data
We can retrain the model to use all the data at the determined optimal value and look at the in-sample accuracy
k = mean_acc.argmax()
knn = knn_classifier(n_neighbors=k)
knn.fit(X, Y)
print("In-Sample Accuracy: ", metrics.accuracy_score(Y, knn.predict(X)))In-Sample Accuracy: 0.425
Decision Trees
Decision Trees allow us to make use of discrete and continuous predictors to find a discrete target
Decision trees test a condition and branch off based on the result, eventually leading to a specific outcome/decision
Algorithm
- Choose a dataset
- Calculate the significance of an attribute in splitting the data
- Split the data based on the value of the attribute
- Go to 1
We aim to have resulting nodes that are high in purity. A higher purity increases predictiveness/significance
Recursive partitining is used to decrease the impurity/entropy in the resulting nodes
Entropy is a measurement of randomness
If samples are equally mixed, the entropy is 1, if the samples are pure, the entropy is 1
The best tree is the one that results in the most information gain after the split
Lab
Import Libraries
import numpy as np
import pandas as pd
from sklearn.tree import DecisionTreeClassifierImport Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/drug200.csv')print(df.shape)
df.head()(200, 6)
| Age | Sex | BP | Cholesterol | Na_to_K | Drug | |
|---|---|---|---|---|---|---|
| 0 | 23 | F | HIGH | HIGH | 25.355 | drugY |
| 1 | 47 | M | LOW | HIGH | 13.093 | drugC |
| 2 | 47 | M | LOW | HIGH | 10.114 | drugC |
| 3 | 28 | F | NORMAL | HIGH | 7.798 | drugX |
| 4 | 61 | F | LOW | HIGH | 18.043 | drugY |
Split X and Y Values
X_headers = ['Age','Sex','BP','Cholesterol','Na_to_K']
X = df[X_headers]
X.head()| Age | Sex | BP | Cholesterol | Na_to_K | |
|---|---|---|---|---|---|
| 0 | 23 | F | HIGH | HIGH | 25.355 |
| 1 | 47 | M | LOW | HIGH | 13.093 |
| 2 | 47 | M | LOW | HIGH | 10.114 |
| 3 | 28 | F | NORMAL | HIGH | 7.798 |
| 4 | 61 | F | LOW | HIGH | 18.043 |
Y = df[['Drug']]
Y.head()| Drug | |
|---|---|
| 0 | drugY |
| 1 | drugC |
| 2 | drugC |
| 3 | drugX |
| 4 | drugY |
Create Numeric Variables
We need to get numeric variables for X as sklearn does not support string categorization (according to the guy in the course anyway)
from sklearn import preprocessingX_arr = np.array(X)
encoder = preprocessing.LabelEncoder()
encoder.fit(['F','M'])
X_arr[:,1] = encoder.transform(X_arr[:,1])
encoder.fit(['LOW','NORMAL','HIGH'])
X_arr[:,2] = encoder.transform(X_arr[:,2])
encoder.fit(['NORMAL','HIGH'])
X_arr[:,3] = encoder.transform(X_arr[:,3])
print(X_arr[0:5])[[23 0 0 0 25.355] [47 1 1 0 13.093] [47 1 1 0 10.113999999999999] [28 0 2 0 7.797999999999999] [61 0 1 0 18.043]]
X_encoded = pd.DataFrame(data=X_arr, columns=X_headers)
X_encoded.head()| Age | Sex | BP | Cholesterol | Na_to_K | |
|---|---|---|---|---|---|
| 0 | 23 | 0 | 0 | 0 | 25.355 |
| 1 | 47 | 1 | 1 | 0 | 13.093 |
| 2 | 47 | 1 | 1 | 0 | 10.114 |
| 3 | 28 | 0 | 2 | 0 | 7.798 |
| 4 | 61 | 0 | 1 | 0 | 18.043 |
Train/Test Split
from sklearn.model_selection import train_test_splitX_train, X_test, Y_train, Y_test = train_test_split(X_encoded, Y, test_size = 0.3)
print('Training: X : {}, Y : {}'.format(X_train.shape,Y_train.shape))
print('Testing: X : {}, Y : {}'.format(X_test.shape,Y_test.shape))Training: X : (140, 5), Y : (140, 1) Testing: X : (60, 5), Y : (60, 1)
Decision Tree
drug_tree = DecisionTreeClassifier(criterion='entropy', max_depth = 4)
drug_treeDecisionTreeClassifier(class_weight=None, criterion='entropy', max_depth=4,
max_features=None, max_leaf_nodes=None,
min_impurity_decrease=0.0, min_impurity_split=None,
min_samples_leaf=1, min_samples_split=2,
min_weight_fraction_leaf=0.0, presort=False, random_state=None,
splitter='best')drug_tree.fit(X_train, Y_train)DecisionTreeClassifier(class_weight=None, criterion='entropy', max_depth=4,
max_features=None, max_leaf_nodes=None,
min_impurity_decrease=0.0, min_impurity_split=None,
min_samples_leaf=1, min_samples_split=2,
min_weight_fraction_leaf=0.0, presort=False, random_state=None,
splitter='best')Prediction
Y_predicted = drug_tree.predict(X_test)print(Y_predicted[0:5])
print(Y_test[0:5])['drugY' 'drugY' 'drugA' 'drugY' 'drugC']
Drug
123 drugY
88 drugY
100 drugA
179 drugY
47 drugC
Evaluation
from sklearn import metricsprint('Decision Tree Accuracy: ', metrics.accuracy_score(Y_test, Y_predicted))Decision Tree Accuracy: 1.0
Visalization
!pip install pydotplus
import matplotlib.pyplot as plt
from sklearn.externals.six import StringIO
import pydotplus
import matplotlib.image as mpimg
from sklearn import treeRequirement not upgraded as not directly required: pydotplus in /opt/conda/envs/DSX-Python35/lib/python3.5/site-packages Requirement not upgraded as not directly required: pyparsing>=2.0.1 in /opt/conda/envs/DSX-Python35/lib/python3.5/site-packages (from pydotplus)
dot_data = StringIO()
filename = 'drug_decision_tree.png'
feature_names = X_headers
target_names = df['Drug'].unique().tolist()out = tree.export_graphviz(drug_tree,
feature_names=feature_names,
out_file=dot_data,
class_names=target_names,
filled=True,
special_characters=True,
rotate=False)graph = pydotplus.graph_from_dot_data(dot_data.getvalue())
graph.write_png(filename)True
img = mpimg.imread(filename)
plt.figure(figsize=(100, 100))
plt.imshow(img, interpolation='nearest')
plt.show()Logistic Regression
Logistic regression is a categorical classification algorithm based on a linear division between categorical values
Logistic regression can be used for binary and multi class classification and predicts the probability of a class which is then mapped to a discrete value
Logistic regression is best suited to
- Binary Classification
- If you need probabilistic results
- Linear decision boundry
- If you need to understand the impact of a feature
A logistic regression can calculate
Logistic vs Linear Regression
We can use linear regression with a dividing line to give whether or not a specific circumstance will lead to a specific output, where we define a threshold value which would define a boundry for the target class
The problem with this method is that we only have a specific binary outcome, and not any information as to what the probability of that outcome is. Logistic regression helps us to define this by making use of a sigmoid to smoothen out the classification boundry, the sigmoid function can be seen below
import numpy as np
from math import exp
import matplotlib.pyplot as plt
x = np.array(range(-100,102,2))/10
sigmoid = 1/(1+np.exp(-1*x))
step = []
for i in range(len(x)):
step.append(1 if x[i] >= 0 else 0)
plt.plot(x,step, label='Step' )
plt.plot(x,sigmoid, label='Sigmoid')
# plt.xlim(-10,10)
plt.ylim(-0.1,1.1)
plt.xlabel('$x$')
plt.ylabel('$\sigma(x)$')
plt.legend()
plt.show()Based on the above we can see that depending on the value of we will have a greater tendency of a value towards 0 or 1 but not explicitly either
Algorithm
- Initialize
- Calculate for an
- Compare and and record the error, defined by a cost function
- Change to reduce the cost
- Go to 2
We can use different ways to change such as gradient descent
Lab
Import Libraries
import pandas as pd
import pylab as pl
import numpy as np
import scipy.optimize as opt
from sklearn import preprocessing
import matplotlib.pyplot as pltImport Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/ChurnData.csv')df.head()| tenure | age | address | income | ed | employ | equip | callcard | wireless | longmon | ... | pager | internet | callwait | confer | ebill | loglong | logtoll | lninc | custcat | churn | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 11.0 | 33.0 | 7.0 | 136.0 | 5.0 | 5.0 | 0.0 | 1.0 | 1.0 | 4.40 | ... | 1.0 | 0.0 | 1.0 | 1.0 | 0.0 | 1.482 | 3.033 | 4.913 | 4.0 | 1.0 |
| 1 | 33.0 | 33.0 | 12.0 | 33.0 | 2.0 | 0.0 | 0.0 | 0.0 | 0.0 | 9.45 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 2.246 | 3.240 | 3.497 | 1.0 | 1.0 |
| 2 | 23.0 | 30.0 | 9.0 | 30.0 | 1.0 | 2.0 | 0.0 | 0.0 | 0.0 | 6.30 | ... | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.841 | 3.240 | 3.401 | 3.0 | 0.0 |
| 3 | 38.0 | 35.0 | 5.0 | 76.0 | 2.0 | 10.0 | 1.0 | 1.0 | 1.0 | 6.05 | ... | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 1.800 | 3.807 | 4.331 | 4.0 | 0.0 |
| 4 | 7.0 | 35.0 | 14.0 | 80.0 | 2.0 | 15.0 | 0.0 | 1.0 | 0.0 | 7.10 | ... | 0.0 | 0.0 | 1.0 | 1.0 | 0.0 | 1.960 | 3.091 | 4.382 | 3.0 | 0.0 |
5 rows × 28 columns
Preprocessing
df = df[['tenure', 'age', 'address', 'income', 'ed', 'employ', 'equip', 'callcard', 'wireless','churn']]
df[['churn']] = df[['churn']].astype('int')
df.head()| tenure | age | address | income | ed | employ | equip | callcard | wireless | churn | |
|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 11.0 | 33.0 | 7.0 | 136.0 | 5.0 | 5.0 | 0.0 | 1.0 | 1.0 | 1 |
| 1 | 33.0 | 33.0 | 12.0 | 33.0 | 2.0 | 0.0 | 0.0 | 0.0 | 0.0 | 1 |
| 2 | 23.0 | 30.0 | 9.0 | 30.0 | 1.0 | 2.0 | 0.0 | 0.0 | 0.0 | 0 |
| 3 | 38.0 | 35.0 | 5.0 | 76.0 | 2.0 | 10.0 | 1.0 | 1.0 | 1.0 | 0 |
| 4 | 7.0 | 35.0 | 14.0 | 80.0 | 2.0 | 15.0 | 0.0 | 1.0 | 0.0 | 0 |
Define X and Y
X = np.asarray(df[['tenure', 'age', 'address', 'income', 'ed', 'employ', 'equip']])
X[0:5]array([[ 11., 33., 7., 136., 5., 5., 0.],
[ 33., 33., 12., 33., 2., 0., 0.],
[ 23., 30., 9., 30., 1., 2., 0.],
[ 38., 35., 5., 76., 2., 10., 1.],
[ 7., 35., 14., 80., 2., 15., 0.]])Y = np.asarray(df['churn'])
Y[0:5]array([1, 1, 0, 0, 0])
Normalize Data
from sklearn import preprocessingX = preprocessing.StandardScaler().fit(X).transform(X)
X[0:5]array([[-1.13518441, -0.62595491, -0.4588971 , 0.4751423 , 1.6961288 ,
-0.58477841, -0.85972695],
[-0.11604313, -0.62595491, 0.03454064, -0.32886061, -0.6433592 ,
-1.14437497, -0.85972695],
[-0.57928917, -0.85594447, -0.261522 , -0.35227817, -1.42318853,
-0.92053635, -0.85972695],
[ 0.11557989, -0.47262854, -0.65627219, 0.00679109, -0.6433592 ,
-0.02518185, 1.16316 ],
[-1.32048283, -0.47262854, 0.23191574, 0.03801451, -0.6433592 ,
0.53441472, -0.85972695]])Train/Test Split
from sklearn.model_selection import train_test_splitX_train, X_test, Y_train, Y_test = train_test_split(X, Y, test_size=0.2, random_state=4)print('Train: ', X_train.shape, Y_train.shape)
print('Test: ', X_test.shape, Y_test.shape)Train: (160, 7) (160,) Test: (40, 7) (40,)
Modelling
from sklearn.linear_model import LogisticRegression
from sklearn.metrics import confusion_matrixlr = LogisticRegression(C=0.01, solver='liblinear').fit(X_train, Y_train)
lrLogisticRegression(C=0.01, class_weight=None, dual=False, fit_intercept=True,
intercept_scaling=1, max_iter=100, multi_class='ovr', n_jobs=1,
penalty='l2', random_state=None, solver='liblinear', tol=0.0001,
verbose=0, warm_start=False)Predict
Y_hat = lr.predict(X_test)Y_hat_prob = lr.predict_proba(X_test)
Y_hat_prob[0:5]array([[ 0.54132919, 0.45867081],
[ 0.60593357, 0.39406643],
[ 0.56277713, 0.43722287],
[ 0.63432489, 0.36567511],
[ 0.56431839, 0.43568161]])Evaluation
Jaccard Index
from sklearn.metrics import jaccard_similarity_scorejaccard_similarity_score(Y_test, Y_hat)0.75
from sklearn.metrics import classification_report, confusion_matrix
import itertoolsdef plot_confusion_matrix(cm, classes,
normalize=False,
title='Confusion matrix',
cmap=plt.cm.Blues):
"""
This function prints and plots the confusion matrix.
Normalization can be applied by setting `normalize=True`.
"""
if normalize:
cm = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis]
print("Normalized confusion matrix")
else:
print('Confusion matrix, without normalization')
print(cm)
plt.imshow(cm, interpolation='nearest', cmap=cmap)
plt.title(title)
plt.colorbar()
tick_marks = np.arange(len(classes))
plt.xticks(tick_marks, classes, rotation=45)
plt.yticks(tick_marks, classes)
fmt = '.2f' if normalize else 'd'
thresh = cm.max() / 2.
for i, j in itertools.product(range(cm.shape[0]), range(cm.shape[1])):
plt.text(j, i, format(cm[i, j], fmt),
horizontalalignment="center",
color="white" if cm[i, j] > thresh else "black")
plt.tight_layout()
plt.ylabel('True label')
plt.xlabel('Predicted label')print(confusion_matrix(Y_test, Y_hat, labels=[1,0]))[[ 6 9] [ 1 24]]
# Compute confusion matrix
cnf_matrix = confusion_matrix(Y_test, Y_hat, labels=[1,0])
np.set_printoptions(precision=2)
# Plot non-normalized confusion matrix
plt.figure()
plot_confusion_matrix(cnf_matrix, classes=['churn=1','churn=0'],normalize= False, title='Confusion matrix')Confusion matrix, without normalization [[ 6 9] [ 1 24]]
print(classification_report(Y_test, Y_hat)) precision recall f1-score support
0 0.73 0.96 0.83 25
1 0.86 0.40 0.55 15
avg / total 0.78 0.75 0.72 40
from sklearn.metrics import log_losslog_loss(Y_hat, Y_hat_prob)0.54903192026736869
Using Different Model Parameters
lr2 = LogisticRegression(C=10, solver='sag').fit(X_train,Y_train)
Y_hat_prob2 = lr2.predict_proba(X_test)
print ("LogLoss: : %.2f" % log_loss(Y_test, Y_hat_prob2))LogLoss: : 0.63
Support Vector Machine
SVM is a supervised algorithm that classifies data by finding a separator
- Map data to higher-dimensional Feature Space
- Find a separating hyperplane in higher dimensional space
Data Transformation
Mapping data into a higher space is known as kernelling and can be of different functions such as
- Linear
- Polynomial
- RBF
- Sigmoid
The best hyperplane is the one that results in the largest margin possible between the hyperplane and our closest sample, the samples closest to our hyperlane are known as support vectors
Advantages and Disadvantages
Advantages
- Accurate in high dimensional spaces
- Memory efficient
Disadvantages
Prone to overfitting
No probability estimation
Not suited to very large datasets
Applications
Image Recognition
Text mining/categorization
- Spam detection
- Sentiment analysis
Regression
Outlier detection
Clustering
Lab
Import Packages
import pandas as pd
import pylab as pl
import numpy as np
import scipy.optimize as opt
from sklearn import preprocessing
from sklearn.model_selection import train_test_split
import matplotlib.pyplot as pltImport Data
The data is from the UCI Machine Learning Archive, the fields are as follows
| Field name | Description |
|---|---|
| ID | Clump thickness |
| Clump | Clump thickness |
| UnifSize | Uniformity of cell size |
| UnifShape | Uniformity of cell shape |
| MargAdh | Marginal adhesion |
| SingEpiSize | Single epithelial cell size |
| BareNuc | Bare nuclei |
| BlandChrom | Bland chromatin |
| NormNucl | Normal nucleoli |
| Mit | Mitoses |
| Class | Benign or malignant |
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/cell_samples.csv')df.head()| ID | Clump | UnifSize | UnifShape | MargAdh | SingEpiSize | BareNuc | BlandChrom | NormNucl | Mit | Class | |
|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1000025 | 5 | 1 | 1 | 1 | 2 | 1 | 3 | 1 | 1 | 2 |
| 1 | 1002945 | 5 | 4 | 4 | 5 | 7 | 10 | 3 | 2 | 1 | 2 |
| 2 | 1015425 | 3 | 1 | 1 | 1 | 2 | 2 | 3 | 1 | 1 | 2 |
| 3 | 1016277 | 6 | 8 | 8 | 1 | 3 | 4 | 3 | 7 | 1 | 2 |
| 4 | 1017023 | 4 | 1 | 1 | 3 | 2 | 1 | 3 | 1 | 1 | 2 |
Visualization
The Class field contains the diagnosis where 2 means benign, and 4 means malignant
ax = df[df['Class'] == 4][0:50].plot(kind='scatter',
x='Clump',
y='UnifSize',
color='DarkBlue',
label='malignant');
df[df['Class'] == 2][0:50].plot(kind='scatter',
x='Clump',
y='UnifSize',
color='Yellow',
label='benign',
ax=ax);
plt.show()Preprocessing Data
print(df.dtypes)ID int64 Clump int64 UnifSize int64 UnifShape int64 MargAdh int64 SingEpiSize int64 BareNuc object BlandChrom int64 NormNucl int64 Mit int64 Class int64 dtype: object
df = df[pd.to_numeric(df['BareNuc'].apply(lambda x: x.isnumeric()))]
df['BareNuc'] = df['BareNuc'].astype('int')
df.dtypesID int64 Clump int64 UnifSize int64 UnifShape int64 MargAdh int64 SingEpiSize int64 BareNuc int64 BlandChrom int64 NormNucl int64 Mit int64 Class int64 dtype: object
Break into X and Y
X = np.asarray(df[['Clump', 'UnifSize', 'UnifShape', 'MargAdh', 'SingEpiSize', 'BareNuc', 'BlandChrom', 'NormNucl', 'Mit']])
X[0:5]array([[ 5, 1, 1, 1, 2, 1, 3, 1, 1],
[ 5, 4, 4, 5, 7, 10, 3, 2, 1],
[ 3, 1, 1, 1, 2, 2, 3, 1, 1],
[ 6, 8, 8, 1, 3, 4, 3, 7, 1],
[ 4, 1, 1, 3, 2, 1, 3, 1, 1]])Y = np.asarray(df['Class'])
Y[0:5]array([2, 2, 2, 2, 2])
Train/Test Split
X_train, X_test, Y_train, Y_test = train_test_split(X, Y,
test_size=0.2,
random_state=4)
print ('Train set:', X_train.shape, Y_train.shape)
print ('Test set:', X_test.shape, Y_test.shape)Train set: (546, 9) (546,) Test set: (137, 9) (137,)
Modeling
from sklearn import svmclf = svm.SVC(gamma='auto', kernel='rbf')
clf.fit(X_train, Y_train)SVC(C=1.0, cache_size=200, class_weight=None, coef0=0.0, decision_function_shape='ovr', degree=3, gamma='auto', kernel='rbf', max_iter=-1, probability=False, random_state=None, shrinking=True, tol=0.001, verbose=False)
Y_hat = clf.predict(X_test)
Y_hat[0:5]array([2, 4, 2, 4, 2])
Evaluation
from sklearn.metrics import classification_report, confusion_matrix
import itertoolsdef plot_confusion_matrix(cm, classes,
normalize=False,
title='Confusion matrix',
cmap=plt.cm.Blues):
"""
This function prints and plots the confusion matrix.
Normalization can be applied by setting `normalize=True`.
"""
if normalize:
cm = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis]
print("Normalized confusion matrix")
else:
print('Confusion matrix, without normalization')
print(cm)
plt.imshow(cm, interpolation='nearest', cmap=cmap)
plt.title(title)
plt.colorbar()
tick_marks = np.arange(len(classes))
plt.xticks(tick_marks, classes, rotation=45)
plt.yticks(tick_marks, classes)
fmt = '.2f' if normalize else 'd'
thresh = cm.max() / 2.
for i, j in itertools.product(range(cm.shape[0]), range(cm.shape[1])):
plt.text(j, i, format(cm[i, j], fmt),
horizontalalignment="center",
color="white" if cm[i, j] > thresh else "black")
plt.tight_layout()
plt.ylabel('True label')
plt.xlabel('Predicted label')# Compute confusion matrix
cnf_matrix = confusion_matrix(Y_test, Y_hat, labels=[2,4])
np.set_printoptions(precision=2)
print (classification_report(Y_test, Y_hat))
# Plot non-normalized confusion matrix
plt.figure()
plot_confusion_matrix(cnf_matrix, classes=['Benign(2)','Malignant(4)'],
normalize= False, title='Confusion matrix') precision recall f1-score support
2 1.00 0.94 0.97 90
4 0.90 1.00 0.95 47
avg / total 0.97 0.96 0.96 137
Confusion matrix, without normalization
[[85 5]
[ 0 47]]
from sklearn.metrics import f1_score
print('F1 Score: ', f1_score(Y_test, Y_hat, average='weighted'))F1 Score: 0.96390389821
from sklearn.metrics import jaccard_similarity_score
print('Jaccard Index: ', jaccard_similarity_score(Y_test, Y_hat))Jaccard Index: 0.963503649635
Using an Alternative Kernal
clf2 = svm.SVC(kernel='linear')
clf2.fit(X_train, Y_train)
Y_hat2 = clf2.predict(X_test)
print("Avg F1-score: %.4f" % f1_score(Y_test, Y_hat2, average='weighted'))
print("Jaccard score: %.4f" % jaccard_similarity_score(Y_test, Y_hat2))Avg F1-score: 0.9639 Jaccard score: 0.9635
Clustering
Clustering is an unsupervised grouping of data in which similar datapoints are grouped together
The diference between clustering and classification is that clustering does not speficy what th groupings should be
Uses of Clustering
- Exploration of data
- Summary Generation
- Outlier Detection
- Finding Duplicates
- Data Pre-Processing
Clustering Algorithms
- Partitioned Based
- Efficient
- Hierachical
- Produces trees of clusters
- Density based
- Produces arbitrary shaped clusters
K-Means
- Partitioning Clustering
- Divides data into K non-overlapping subsets
K tries to minimize intra-cluster distances, and maximize inter-cluster distances
Distance
We can define the distance simply as the euclidean distance, typically normalizing the values so that our distances are not affected more by one value than another
Other distance formulas can be used depending on our understanding of the data as appropriate
Algorithm
- Determine K and initialize centroids randomly
- Measure distance from centroids to each datapoint
- Assign each point to closest centroid
- New centroids are at the mean of the points in its cluster
- Go to 2 if not converged
K-Means may not converge to a global optimum, but simply a local one and is somewhat dependant on the intial choice in 1
Accuracy
Average distance between datapoints within a cluster is a measure of error
Choice of K
We can use the elbow method in which we look at the distance of the datapoints to their centroid versus the K value, and select the one at which we notice a sharp change in the distance gradient
Lab
Import Packages
import numpy as np
import pandas as pd
import matplotlib.pyplot as plt
from sklearn.cluster import KMeans
# from sklearn.datasets.samples_generator import make_blobs Import Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/Cust_Segmentation.csv')df.head()| Customer Id | Age | Edu | Years Employed | Income | Card Debt | Other Debt | Defaulted | Address | DebtIncomeRatio | |
|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1 | 41 | 2 | 6 | 19 | 0.124 | 1.073 | 0.0 | NBA001 | 6.3 |
| 1 | 2 | 47 | 1 | 26 | 100 | 4.582 | 8.218 | 0.0 | NBA021 | 12.8 |
| 2 | 3 | 33 | 2 | 10 | 57 | 6.111 | 5.802 | 1.0 | NBA013 | 20.9 |
| 3 | 4 | 29 | 2 | 4 | 19 | 0.681 | 0.516 | 0.0 | NBA009 | 6.3 |
| 4 | 5 | 47 | 1 | 31 | 253 | 9.308 | 8.908 | 0.0 | NBA008 | 7.2 |
df = df.drop('Address', axis=1)
df.head()| Customer Id | Age | Edu | Years Employed | Income | Card Debt | Other Debt | Defaulted | DebtIncomeRatio | |
|---|---|---|---|---|---|---|---|---|---|
| 0 | 1 | 41 | 2 | 6 | 19 | 0.124 | 1.073 | 0.0 | 6.3 |
| 1 | 2 | 47 | 1 | 26 | 100 | 4.582 | 8.218 | 0.0 | 12.8 |
| 2 | 3 | 33 | 2 | 10 | 57 | 6.111 | 5.802 | 1.0 | 20.9 |
| 3 | 4 | 29 | 2 | 4 | 19 | 0.681 | 0.516 | 0.0 | 6.3 |
| 4 | 5 | 47 | 1 | 31 | 253 | 9.308 | 8.908 | 0.0 | 7.2 |
Normalize the Data
from sklearn.preprocessing import StandardScalerX = np.asarray(df.values[:,1:])
X = np.nan_to_num(X)
Xarray([[ 41. , 2. , 6. , ..., 1.07, 0. , 6.3 ],
[ 47. , 1. , 26. , ..., 8.22, 0. , 12.8 ],
[ 33. , 2. , 10. , ..., 5.8 , 1. , 20.9 ],
...,
[ 25. , 4. , 0. , ..., 3.21, 1. , 33.4 ],
[ 32. , 1. , 12. , ..., 0.7 , 0. , 2.9 ],
[ 52. , 1. , 16. , ..., 3.64, 0. , 8.6 ]])X_norm = StandardScaler().fit_transform(X)
X_normarray([[ 0.74, 0.31, -0.38, ..., -0.59, -0.52, -0.58],
[ 1.49, -0.77, 2.57, ..., 1.51, -0.52, 0.39],
[-0.25, 0.31, 0.21, ..., 0.8 , 1.91, 1.6 ],
...,
[-1.25, 2.47, -1.26, ..., 0.04, 1.91, 3.46],
[-0.38, -0.77, 0.51, ..., -0.7 , -0.52, -1.08],
[ 2.11, -0.77, 1.1 , ..., 0.16, -0.52, -0.23]])Modeling
k = 3
k_means = KMeans(init='k-means++',
n_clusters=k,
n_init=12)k_means.fit(X)KMeans(algorithm='auto', copy_x=True, init='k-means++', max_iter=300,
n_clusters=3, n_init=12, n_jobs=1, precompute_distances='auto',
random_state=None, tol=0.0001, verbose=0)labels = k_means.labels_
print(labels[:20], labels.shape)[1 0 1 1 2 0 1 0 1 0 0 1 1 1 1 1 1 1 0 1] (850,)
df['Cluster'] = labels
df.head()| Customer Id | Age | Edu | Years Employed | Income | Card Debt | Other Debt | Defaulted | DebtIncomeRatio | Cluster | |
|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1 | 41 | 2 | 6 | 19 | 0.124 | 1.073 | 0.0 | 6.3 | 1 |
| 1 | 2 | 47 | 1 | 26 | 100 | 4.582 | 8.218 | 0.0 | 12.8 | 0 |
| 2 | 3 | 33 | 2 | 10 | 57 | 6.111 | 5.802 | 1.0 | 20.9 | 1 |
| 3 | 4 | 29 | 2 | 4 | 19 | 0.681 | 0.516 | 0.0 | 6.3 | 1 |
| 4 | 5 | 47 | 1 | 31 | 253 | 9.308 | 8.908 | 0.0 | 7.2 | 2 |
df.groupby('Cluster').mean()| Customer Id | Age | Edu | Years Employed | Income | Card Debt | Other Debt | Defaulted | DebtIncomeRatio | |
|---|---|---|---|---|---|---|---|---|---|
| Cluster | |||||||||
| 0 | 402.295082 | 41.333333 | 1.956284 | 15.256831 | 83.928962 | 3.103639 | 5.765279 | 0.171233 | 10.724590 |
| 1 | 432.468413 | 32.964561 | 1.614792 | 6.374422 | 31.164869 | 1.032541 | 2.104133 | 0.285185 | 10.094761 |
| 2 | 410.166667 | 45.388889 | 2.666667 | 19.555556 | 227.166667 | 5.678444 | 10.907167 | 0.285714 | 7.322222 |
Visualization
%matplotlib inline
area = np.pi*(X[:,1])**2
plt.figure()
plt.title('Income vs Age')
plt.scatter(X[:,0], X[:,3], s=area, c=labels, alpha=0.5)
plt.xlabel('Age')
plt.ylabel('Income')
plt.show()from mpl_toolkits.mplot3d import Axes3Dplt.clf()
ax = Axes3D(plt.figure(figsize=(8,6)), rect=[0,0,0.95,1], elev=48, azim=134)
plt.cla()
ax.set_xlabel('Education')
ax.set_ylabel('Age')
ax.set_zlabel('Income')
ax.scatter(X[:,1], X[:,0], X[:,3], c=labels)
plt.figure()
plt.show()<matplotlib.figure.Figure at 0x7f2a4432b828>
<matplotlib.figure.Figure at 0x7f2a9c021e48>
Hierachical Clustering
Two types
- Divisive - Top Down
- Agglomerative - Bottom Up
Agglomerative works by combining clusters based on the distance between them, this is the most popular method for HC
Agglomerative Algorithm
- Create n clusters, one for each datapoint
- Compute the proximity matrix
- Repeat Until a single cluster remains
- Merge the two closest clusters
- Update the proximity matrix
We can use any distance function we want to, there are multiple algorithms for this
- Single linkage clustering
- Complete linkage clustering
- Average linkag clustering
- Centroid linkage clustering
Advantages and Disadvantages
- Advantages
- Number of clusters does not need to be specified
- Easy to implement
- Dendogram can be easily understood
- Disadvantages
- Long runtimes
- Cannot undo previous steps
- Difficult to identify the number of clusters on dendogram
Lab
Import Packages
import numpy as np
import pandas as pd
from scipy import ndimage
from scipy.cluster import hierarchy
from scipy.spatial import distance_matrix
from matplotlib import pyplot as plt
from sklearn import manifold, datasets
from sklearn.cluster import AgglomerativeClustering
from sklearn.datasets.samples_generator import make_blobsImport Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/cars_clus.csv')df.head()| manufact | model | sales | resale | type | price | engine_s | horsepow | wheelbas | width | length | curb_wgt | fuel_cap | mpg | lnsales | partition | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | Acura | Integra | 16.919 | 16.360 | 0.000 | 21.500 | 1.800 | 140.000 | 101.200 | 67.300 | 172.400 | 2.639 | 13.200 | 28.000 | 2.828 | 0.0 |
| 1 | Acura | TL | 39.384 | 19.875 | 0.000 | 28.400 | 3.200 | 225.000 | 108.100 | 70.300 | 192.900 | 3.517 | 17.200 | 25.000 | 3.673 | 0.0 |
| 2 | Acura | CL | 14.114 | 18.225 | 0.000 | $null$ | 3.200 | 225.000 | 106.900 | 70.600 | 192.000 | 3.470 | 17.200 | 26.000 | 2.647 | 0.0 |
| 3 | Acura | RL | 8.588 | 29.725 | 0.000 | 42.000 | 3.500 | 210.000 | 114.600 | 71.400 | 196.600 | 3.850 | 18.000 | 22.000 | 2.150 | 0.0 |
| 4 | Audi | A4 | 20.397 | 22.255 | 0.000 | 23.990 | 1.800 | 150.000 | 102.600 | 68.200 | 178.000 | 2.998 | 16.400 | 27.000 | 3.015 | 0.0 |
Clean Data
print ("Shape of dataset before cleaning: ", df.size)
df[[ 'sales', 'resale', 'type', 'price', 'engine_s',
'horsepow', 'wheelbas', 'width', 'length', 'curb_wgt', 'fuel_cap',
'mpg', 'lnsales']] = df[['sales', 'resale', 'type', 'price', 'engine_s',
'horsepow', 'wheelbas', 'width', 'length', 'curb_wgt', 'fuel_cap',
'mpg', 'lnsales']].apply(pd.to_numeric, errors='coerce')
df = df.dropna()
df = df.reset_index(drop=True)
print ("Shape of dataset after cleaning: ", df.size)
df.head()Shape of dataset before cleaning: 2544 Shape of dataset after cleaning: 1872
| manufact | model | sales | resale | type | price | engine_s | horsepow | wheelbas | width | length | curb_wgt | fuel_cap | mpg | lnsales | partition | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | Acura | Integra | 16.919 | 16.360 | 0.0 | 21.50 | 1.8 | 140.0 | 101.2 | 67.3 | 172.4 | 2.639 | 13.2 | 28.0 | 2.828 | 0.0 |
| 1 | Acura | TL | 39.384 | 19.875 | 0.0 | 28.40 | 3.2 | 225.0 | 108.1 | 70.3 | 192.9 | 3.517 | 17.2 | 25.0 | 3.673 | 0.0 |
| 2 | Acura | RL | 8.588 | 29.725 | 0.0 | 42.00 | 3.5 | 210.0 | 114.6 | 71.4 | 196.6 | 3.850 | 18.0 | 22.0 | 2.150 | 0.0 |
| 3 | Audi | A4 | 20.397 | 22.255 | 0.0 | 23.99 | 1.8 | 150.0 | 102.6 | 68.2 | 178.0 | 2.998 | 16.4 | 27.0 | 3.015 | 0.0 |
| 4 | Audi | A6 | 18.780 | 23.555 | 0.0 | 33.95 | 2.8 | 200.0 | 108.7 | 76.1 | 192.0 | 3.561 | 18.5 | 22.0 | 2.933 | 0.0 |
Selecting Features
X = df[['engine_s','horsepow', 'wheelbas',
'width', 'length', 'curb_wgt',
'fuel_cap', 'mpg']].values
print(X[:5])[[ 1.8 140. 101.2 67.3 172.4 2.64 13.2 28. ] [ 3.2 225. 108.1 70.3 192.9 3.52 17.2 25. ] [ 3.5 210. 114.6 71.4 196.6 3.85 18. 22. ] [ 1.8 150. 102.6 68.2 178. 3. 16.4 27. ] [ 2.8 200. 108.7 76.1 192. 3.56 18.5 22. ]]
Normalization
from sklearn.preprocessing import MinMaxScaler
X_norm = MinMaxScaler().fit_transform(X)
print(X_norm[:5])[[ 0.11 0.22 0.19 0.28 0.31 0.23 0.13 0.43] [ 0.31 0.43 0.34 0.46 0.58 0.5 0.32 0.33] [ 0.36 0.39 0.48 0.53 0.63 0.61 0.35 0.23] [ 0.11 0.24 0.22 0.34 0.38 0.34 0.28 0.4 ] [ 0.26 0.37 0.35 0.81 0.57 0.52 0.38 0.23]]
Clustering with Scipy
import scipy as sp
entries = X_norm.shape[0]
D = sp.zeros([entries, entries])
for i in range(entries):
for j in range(entries):
D[i,j] = sp.spatial.distance.euclidean(X[i],X[j])
print(D)[[ 0. 87.92 75.8 ..., 16.64 28.08 26.83] [ 87.92 0. 17.09 ..., 75.6 115.32 114.34] [ 75.8 17.09 0. ..., 62.15 103.4 102.08] ..., [ 16.64 75.6 62.15 ..., 0. 43.35 41.45] [ 28.08 115.32 103.4 ..., 43.35 0. 3.76] [ 26.83 114.34 102.08 ..., 41.45 3.76 0. ]]
We have different distace formulas such as
- single
- complete
- average
- weighted
- centroid
import pylab
import scipy.cluster.hierarchyZ = hierarchy.linkage(D, 'complete')
print(Z[:5])[[ 3.60e+01 9.20e+01 7.15e-03 2.00e+00] [ 2.80e+01 9.00e+01 1.14e-02 2.00e+00] [ 4.10e+01 7.40e+01 7.12e-02 2.00e+00] [ 1.12e+02 1.16e+02 1.65e-01 2.00e+00] [ 7.60e+01 8.40e+01 4.36e-01 2.00e+00]]
/opt/conda/envs/DSX-Python35/lib/python3.5/site-packages/ipykernel/__main__.py:1: ClusterWarning: scipy.cluster: The symmetric non-negative hollow observation matrix looks suspiciously like an uncondensed distance matrix if __name__ == '__main__':
from scipy.cluster.hierarchy import fclustermax_d = 3
clusters = fcluster(Z, max_d, criterion='distance')
print(clusters)[ 51 102 95 59 83 3 46 47 38 80 99 97 4 7 84 20 30 39 40 82 9 19 29 70 31 89 56 78 55 71 32 108 76 41 50 13 66 22 44 33 73 88 90 75 81 14 77 23 58 60 87 96 12 52 64 104 28 42 48 94 103 8 5 106 26 68 65 92 72 85 35 15 16 74 88 91 37 43 100 6 2 17 69 101 37 34 67 79 45 49 55 56 66 63 36 82 86 98 107 1 1 10 11 18 19 57 93 53 54 21 61 105 24 27 62 25 24]
max_d = 5
clusters = fcluster(Z, max_d, criterion='maxclust')
print(clusters)[3 4 4 3 4 1 3 3 3 4 4 4 1 1 4 2 3 3 3 4 1 2 2 3 3 4 3 4 3 3 3 5 4 3 3 2 3 2 3 3 3 4 4 3 4 2 4 2 3 3 4 4 2 3 3 4 2 3 3 4 4 1 1 4 2 3 3 4 3 4 3 2 2 3 4 4 3 3 4 1 1 2 3 4 3 3 3 4 3 3 3 3 3 3 3 4 4 4 4 1 1 2 2 2 2 3 4 3 3 2 3 4 2 2 3 2 2]
fig = pylab.figure(figsize=(18,50))
def llf(id):
return '[%s %s %s]' % (df['manufact'][id],
df['model'][id],
int(float(df['type'][id])))
dendro = hierarchy.dendrogram(Z, leaf_label_func=llf,
leaf_rotation=0,
leaf_font_size=12,
orientation='right')Clustering with SciKit Learn
D = distance_matrix(X, X)
print(D)[[ 0. 87.92 75.8 ..., 16.64 28.08 26.83] [ 87.92 0. 17.09 ..., 75.6 115.32 114.34] [ 75.8 17.09 0. ..., 62.15 103.4 102.08] ..., [ 16.64 75.6 62.15 ..., 0. 43.35 41.45] [ 28.08 115.32 103.4 ..., 43.35 0. 3.76] [ 26.83 114.34 102.08 ..., 41.45 3.76 0. ]]
agglom = AgglomerativeClustering(n_clusters=6, linkage='complete')agglom.fit(X)AgglomerativeClustering(affinity='euclidean', compute_full_tree='auto',
connectivity=None, linkage='complete', memory=None,
n_clusters=6, pooling_func=<function mean at 0x7f2ad42c3730>)df['cluster_'] = agglom.labels_
df.head()| manufact | model | sales | resale | type | price | engine_s | horsepow | wheelbas | width | length | curb_wgt | fuel_cap | mpg | lnsales | partition | cluster_ | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | Acura | Integra | 16.919 | 16.360 | 0.0 | 21.50 | 1.8 | 140.0 | 101.2 | 67.3 | 172.4 | 2.639 | 13.2 | 28.0 | 2.828 | 0.0 | 2 |
| 1 | Acura | TL | 39.384 | 19.875 | 0.0 | 28.40 | 3.2 | 225.0 | 108.1 | 70.3 | 192.9 | 3.517 | 17.2 | 25.0 | 3.673 | 0.0 | 0 |
| 2 | Acura | RL | 8.588 | 29.725 | 0.0 | 42.00 | 3.5 | 210.0 | 114.6 | 71.4 | 196.6 | 3.850 | 18.0 | 22.0 | 2.150 | 0.0 | 0 |
| 3 | Audi | A4 | 20.397 | 22.255 | 0.0 | 23.99 | 1.8 | 150.0 | 102.6 | 68.2 | 178.0 | 2.998 | 16.4 | 27.0 | 3.015 | 0.0 | 3 |
| 4 | Audi | A6 | 18.780 | 23.555 | 0.0 | 33.95 | 2.8 | 200.0 | 108.7 | 76.1 | 192.0 | 3.561 | 18.5 | 22.0 | 2.933 | 0.0 | 0 |
import matplotlib.cm as cm
n_clusters = max(agglom.labels_)+1
colors = cm.rainbow(np.linspace(0,1,n_clusters))
cluster_labels = list(range(0,n_clusters))
plt.figure(figsize=(16,14))
for color, label in zip(colors, cluster_labels):
subset = df[df.cluster_ == label]
for i in subset.index:
plt.text(subset.horsepow[i],
subset.mpg[i],
str(subset['model'][i]),
rotation=25)
plt.scatter(subset.horsepow, subset.mpg,
s= subset.price*10, c=color,
label='cluster'+str(label),alpha=0.5)
plt.legend()
plt.title('Clusters')
plt.xlabel('horsepow')
plt.ylabel('mpg')
plt.show()df.groupby(['cluster_','type'])['cluster_'].count()cluster_ type
0 0.0 29
1.0 14
1 0.0 10
2 0.0 26
1.0 4
3 0.0 21
1.0 11
4 0.0 1
5 0.0 1
Name: cluster_, dtype: int64df_mean = df.groupby(['cluster_','type'])['horsepow','engine_s','mpg','price'].mean()
df_mean| horsepow | engine_s | mpg | price | ||
|---|---|---|---|---|---|
| cluster_ | type | ||||
| 0 | 0.0 | 210.551724 | 3.420690 | 23.648276 | 30.449310 |
| 1.0 | 206.428571 | 4.064286 | 18.500000 | 28.727714 | |
| 1 | 0.0 | 294.700000 | 4.380000 | 21.600000 | 57.864000 |
| 2 | 0.0 | 121.230769 | 1.934615 | 29.115385 | 14.720385 |
| 1.0 | 133.750000 | 2.225000 | 22.750000 | 15.856500 | |
| 3 | 0.0 | 160.857143 | 2.680952 | 24.857143 | 19.822048 |
| 1.0 | 154.272727 | 2.936364 | 20.909091 | 21.199364 | |
| 4 | 0.0 | 55.000000 | 1.000000 | 45.000000 | 9.235000 |
| 5 | 0.0 | 450.000000 | 8.000000 | 16.000000 | 69.725000 |
plt.figure(figsize=(16,10))
for color, label in zip(colors, cluster_labels):
subset = df_mean.loc[(label,),]
for i in subset.index:
plt.text(subset.loc[i][0]+5, subset.loc[i][2], 'type='+str(int(i)) + ', price='+str(int(subset.loc[i][3]))+'k')
plt.scatter(subset.horsepow, subset.mpg, s=subset.price*20, c=color, label='cluster'+str(label))
plt.legend()
plt.title('Clusters')
plt.xlabel('horsepow')
plt.ylabel('mpg')Text(0,0.5,'mpg')
DBSCAN
Density Based clstering locates regions of high density and separates outliers while being able to find arbitrarily shaped clusters while ignoring noise
- Density Based Spacial Clustering of Applications with Noise
- Common clustering algorithm
- Based on object density
- Radius of neighborhood
- Min number of neighbors
Different types of points
- Core
- Has M neighbors withn R
- Border
- Has Core point within R, less than M in R
- Outlier
- Not Core, or within R of Core
DBSCAN visits each point and identifies its type, and then groups points based on this
Lab
Import Packages
import numpy as np
from sklearn.cluster import DBSCAN
from sklearn.datasets.samples_generator import make_blobs
from sklearn.preprocessing import StandardScaler
import matplotlib.pyplot as plt
import pandas as pdAbout the Data
Environment Canada
Monthly Values for July - 2015
| Name in the table | Meaning |
|---|---|
| Stn_Name | Station Name |
| Lat | Latitude (North+, degrees) |
| Long | Longitude (West - , degrees) |
| Prov | Province |
| Tm | Mean Temperature (°C) |
| DwTm | Days without Valid Mean Temperature |
| D | Mean Temperature difference from Normal (1981-2010) (°C) |
| Tx | Highest Monthly Maximum Temperature (°C) |
| DwTx | Days without Valid Maximum Temperature |
| Tn | Lowest Monthly Minimum Temperature (°C) |
| DwTn | Days without Valid Minimum Temperature |
| S | Snowfall (cm) |
| DwS | Days without Valid Snowfall |
| S%N | Percent of Normal (1981-2010) Snowfall |
| P | Total Precipitation (mm) |
| DwP | Days without Valid Precipitation |
| P%N | Percent of Normal (1981-2010) Precipitation |
| S_G | Snow on the ground at the end of the month (cm) |
| Pd | Number of days with Precipitation 1.0 mm or more |
| BS | Bright Sunshine (hours) |
| DwBS | Days without Valid Bright Sunshine |
| BS% | Percent of Normal (1981-2010) Bright Sunshine |
| HDD | Degree Days below 18 °C |
| CDD | Degree Days above 18 °C |
| Stn_No | Climate station identifier (first 3 digits indicate drainage basin, last 4 characters are for sorting alphabetically). |
| NA | Not Available |
Import the Data
df = pd.read_csv('https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/weather-stations20140101-20141231.csv')df.head()| Stn_Name | Lat | Long | Prov | Tm | DwTm | D | Tx | DwTx | Tn | ... | DwP | P%N | S_G | Pd | BS | DwBS | BS% | HDD | CDD | Stn_No | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | CHEMAINUS | 48.935 | -123.742 | BC | 8.2 | 0.0 | NaN | 13.5 | 0.0 | 1.0 | ... | 0.0 | NaN | 0.0 | 12.0 | NaN | NaN | NaN | 273.3 | 0.0 | 1011500 |
| 1 | COWICHAN LAKE FORESTRY | 48.824 | -124.133 | BC | 7.0 | 0.0 | 3.0 | 15.0 | 0.0 | -3.0 | ... | 0.0 | 104.0 | 0.0 | 12.0 | NaN | NaN | NaN | 307.0 | 0.0 | 1012040 |
| 2 | LAKE COWICHAN | 48.829 | -124.052 | BC | 6.8 | 13.0 | 2.8 | 16.0 | 9.0 | -2.5 | ... | 9.0 | NaN | NaN | 11.0 | NaN | NaN | NaN | 168.1 | 0.0 | 1012055 |
| 3 | DISCOVERY ISLAND | 48.425 | -123.226 | BC | NaN | NaN | NaN | 12.5 | 0.0 | NaN | ... | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | NaN | 1012475 |
| 4 | DUNCAN KELVIN CREEK | 48.735 | -123.728 | BC | 7.7 | 2.0 | 3.4 | 14.5 | 2.0 | -1.0 | ... | 2.0 | NaN | NaN | 11.0 | NaN | NaN | NaN | 267.7 | 0.0 | 1012573 |
5 rows × 25 columns
Clean Data
df = df[pd.notnull(df['Tm'])]
df.reset_index(drop=True)
df.head()| Stn_Name | Lat | Long | Prov | Tm | DwTm | D | Tx | DwTx | Tn | ... | DwP | P%N | S_G | Pd | BS | DwBS | BS% | HDD | CDD | Stn_No | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | CHEMAINUS | 48.935 | -123.742 | BC | 8.2 | 0.0 | NaN | 13.5 | 0.0 | 1.0 | ... | 0.0 | NaN | 0.0 | 12.0 | NaN | NaN | NaN | 273.3 | 0.0 | 1011500 |
| 1 | COWICHAN LAKE FORESTRY | 48.824 | -124.133 | BC | 7.0 | 0.0 | 3.0 | 15.0 | 0.0 | -3.0 | ... | 0.0 | 104.0 | 0.0 | 12.0 | NaN | NaN | NaN | 307.0 | 0.0 | 1012040 |
| 2 | LAKE COWICHAN | 48.829 | -124.052 | BC | 6.8 | 13.0 | 2.8 | 16.0 | 9.0 | -2.5 | ... | 9.0 | NaN | NaN | 11.0 | NaN | NaN | NaN | 168.1 | 0.0 | 1012055 |
| 4 | DUNCAN KELVIN CREEK | 48.735 | -123.728 | BC | 7.7 | 2.0 | 3.4 | 14.5 | 2.0 | -1.0 | ... | 2.0 | NaN | NaN | 11.0 | NaN | NaN | NaN | 267.7 | 0.0 | 1012573 |
| 5 | ESQUIMALT HARBOUR | 48.432 | -123.439 | BC | 8.8 | 0.0 | NaN | 13.1 | 0.0 | 1.9 | ... | 8.0 | NaN | NaN | 12.0 | NaN | NaN | NaN | 258.6 | 0.0 | 1012710 |
5 rows × 25 columns
# ! pip install --user git+https://github.com/matplotlib/basemap.git# from mpl_toolkits.basemap import Basemap
import matplotlib.pyplot as plt
from pylab import rcParamsrcParams['figure.figsize'] = (14,10)
llon=-140
ulon=-50
llat=40
ulat=65
df = df[(df['Long'] > llon) & (df['Long'] < ulon) & (df['Lat'] > llat) &(df['Lat'] < ulat)]
plt.title('Location of Sensors')
plt.scatter(list(df['Long']),list(df['Lat']))
plt.xlabel('Longitude')
plt.ylabel('Latitude')
plt.show()Compute DBSCAN
from sklearn.cluster import DBSCAN
import sklearn.utils
from sklearn.preprocessing import StandardScaler
sklearn.utils.check_random_state(1000)<mtrand.RandomState at 0x7f29c41733a8>
X = np.nan_to_num(df[['Lat','Long']])
X = StandardScaler().fit_transform(X)
Xarray([[-0.3 , -1.17],
[-0.33, -1.19],
[-0.33, -1.18],
...,
[ 1.84, 1.47],
[ 1.01, 1.65],
[ 0.6 , 1.28]])db = DBSCAN(eps=0.15, min_samples=10).fit(X)
dbDBSCAN(algorithm='auto', eps=0.15, leaf_size=30, metric='euclidean',
metric_params=None, min_samples=10, n_jobs=1, p=None)core_samples_mask = np.zeros_like(db.labels_, dtype=bool)
core_samples_mask[db.core_sample_indices_] = True
core_samples_maskarray([ True, True, True, ..., False, False, False], dtype=bool)
df['Clus_db'] = db.labels_
df.head()| Stn_Name | Lat | Long | Prov | Tm | DwTm | D | Tx | DwTx | Tn | ... | P%N | S_G | Pd | BS | DwBS | BS% | HDD | CDD | Stn_No | Clus_db | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | CHEMAINUS | 48.935 | -123.742 | BC | 8.2 | 0.0 | NaN | 13.5 | 0.0 | 1.0 | ... | NaN | 0.0 | 12.0 | NaN | NaN | NaN | 273.3 | 0.0 | 1011500 | 0 |
| 1 | COWICHAN LAKE FORESTRY | 48.824 | -124.133 | BC | 7.0 | 0.0 | 3.0 | 15.0 | 0.0 | -3.0 | ... | 104.0 | 0.0 | 12.0 | NaN | NaN | NaN | 307.0 | 0.0 | 1012040 | 0 |
| 2 | LAKE COWICHAN | 48.829 | -124.052 | BC | 6.8 | 13.0 | 2.8 | 16.0 | 9.0 | -2.5 | ... | NaN | NaN | 11.0 | NaN | NaN | NaN | 168.1 | 0.0 | 1012055 | 0 |
| 4 | DUNCAN KELVIN CREEK | 48.735 | -123.728 | BC | 7.7 | 2.0 | 3.4 | 14.5 | 2.0 | -1.0 | ... | NaN | NaN | 11.0 | NaN | NaN | NaN | 267.7 | 0.0 | 1012573 | 0 |
| 5 | ESQUIMALT HARBOUR | 48.432 | -123.439 | BC | 8.8 | 0.0 | NaN | 13.1 | 0.0 | 1.9 | ... | NaN | NaN | 12.0 | NaN | NaN | NaN | 258.6 | 0.0 | 1012710 | 0 |
5 rows × 26 columns
df[['Stn_Name','Tx','Tm','Clus_db']][1000:1500:45]| Stn_Name | Tx | Tm | Clus_db | |
|---|---|---|---|---|
| 1138 | HEATH POINT | -1.0 | -13.3 | -1 |
| 1185 | LA GRANDE RIVIERE A | -11.6 | -28.4 | -1 |
| 1234 | BRIER ISLAND | 4.4 | -6.3 | 3 |
| 1286 | BRANCH | 8.0 | -3.4 | 4 |
| 1332 | GOOSE A | -4.2 | -22.0 | -1 |
Cluster Visualization
print(df['Clus_db'].max(), df['Clus_db'].min())5 -1
from sklearn.preprocessing import LabelEncoderle = LabelEncoder()
colours = ['#D3D3D3','blue','red','green','purple','yellow','deepskyblue']
le.fit(colours)
le.classes_array(['#D3D3D3', 'blue', 'deepskyblue', 'green', 'purple', 'red', 'yellow'],
dtype='<U11')# le.inverse_transform([0,1,2,3,4,5,6])
df['Colours'] = le.inverse_transform(db.labels_ + 1)
df[['Stn_Name','Tx','Tm','Clus_db', 'Colours']][1000:1500:45]| Stn_Name | Tx | Tm | Clus_db | Colours | |
|---|---|---|---|---|---|
| 1138 | HEATH POINT | -1.0 | -13.3 | -1 | #D3D3D3 |
| 1185 | LA GRANDE RIVIERE A | -11.6 | -28.4 | -1 | #D3D3D3 |
| 1234 | BRIER ISLAND | 4.4 | -6.3 | 3 | purple |
| 1286 | BRANCH | 8.0 | -3.4 | 4 | red |
| 1332 | GOOSE A | -4.2 | -22.0 | -1 | #D3D3D3 |
plt.title('Clusters')
plt.scatter(list(df['Long']),
list(df['Lat']),
c=list(df['Colours']))
plt.xlabel('Longitude')
plt.ylabel('Latitude')
plt.show()Recommender Systems
Recommender systems try to capture people's behaviour in order to predict what people may like
There are two main types
Content based
- Provide more content similar to what that user likes
Collaborative filtering
A user may be interested in what other similar users like
There are two types of implementations
Memory based
- Uses entire user-item dataset to generate a recommendation
Model based
Develops model of users in an attempt to learn their preferences
Content Based
Content based systems try to recommend content based on a model of the user and similarity of the content that they interact with
Lab
Download the Data
The dataset being used is a movie dataset from GroupLens
#only run once
# !wget -O moviedataset.zip https://s3-api.us-geo.objectstorage.softlayer.net/cf-courses-data/CognitiveClass/ML0101ENv3/labs/moviedataset.zip
# print('unziping ...')
# !unzip -o -j moviedataset.zip Import Packages
import pandas as pd
from math import sqrt
import numpy as np
import matplotlib.pyplot as pltImport Data
movies_df = pd.read_csv('movies.csv')
ratings_df = pd.read_csv('ratings.csv')movies_df.head()| movieId | title | genres | |
|---|---|---|---|
| 0 | 1 | Toy Story (1995) | Adventure|Animation|Children|Comedy|Fantasy |
| 1 | 2 | Jumanji (1995) | Adventure|Children|Fantasy |
| 2 | 3 | Grumpier Old Men (1995) | Comedy|Romance |
| 3 | 4 | Waiting to Exhale (1995) | Comedy|Drama|Romance |
| 4 | 5 | Father of the Bride Part II (1995) | Comedy |
ratings_df.head()| userId | movieId | rating | timestamp | |
|---|---|---|---|---|
| 0 | 1 | 169 | 2.5 | 1204927694 |
| 1 | 1 | 2471 | 3.0 | 1204927438 |
| 2 | 1 | 48516 | 5.0 | 1204927435 |
| 3 | 2 | 2571 | 3.5 | 1436165433 |
| 4 | 2 | 109487 | 4.0 | 1436165496 |
Preprocessing
movies_df['year'] = movies_df.title.str.extract('(\(\d\d\d\d\))',
expand=False)
movies_df['year'] = movies_df.year.str.extract('(\d\d\d\d)',
expand=False)
movies_df['title'] = movies_df.title.str.replace('(\(\d\d\d\d\))', '')
movies_df['title'] = movies_df['title'].apply(lambda x: x.strip())
movies_df.head()| movieId | title | genres | year | |
|---|---|---|---|---|
| 0 | 1 | Toy Story | Adventure|Animation|Children|Comedy|Fantasy | 1995 |
| 1 | 2 | Jumanji | Adventure|Children|Fantasy | 1995 |
| 2 | 3 | Grumpier Old Men | Comedy|Romance | 1995 |
| 3 | 4 | Waiting to Exhale | Comedy|Drama|Romance | 1995 |
| 4 | 5 | Father of the Bride Part II | Comedy | 1995 |
movies_df['genres'] = movies_df.genres.str.split('|')
movies_df.head()| movieId | title | genres | year | |
|---|---|---|---|---|
| 0 | 1 | Toy Story | [Adventure, Animation, Children, Comedy, Fantasy] | 1995 |
| 1 | 2 | Jumanji | [Adventure, Children, Fantasy] | 1995 |
| 2 | 3 | Grumpier Old Men | [Comedy, Romance] | 1995 |
| 3 | 4 | Waiting to Exhale | [Comedy, Drama, Romance] | 1995 |
| 4 | 5 | Father of the Bride Part II | [Comedy] | 1995 |
genres_df = movies_df.copy()
for index, row in movies_df.iterrows():
for genre in row['genres']:
genres_df.at[index, genre] = 1
genres_df = genres_df.fillna(0)
genres_df.head()| movieId | title | genres | year | Adventure | Animation | Children | Comedy | Fantasy | Romance | ... | Horror | Mystery | Sci-Fi | IMAX | Documentary | War | Musical | Western | Film-Noir | (no genres listed) | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1 | Toy Story | [Adventure, Animation, Children, Comedy, Fantasy] | 1995 | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1 | 2 | Jumanji | [Adventure, Children, Fantasy] | 1995 | 1.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2 | 3 | Grumpier Old Men | [Comedy, Romance] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3 | 4 | Waiting to Exhale | [Comedy, Drama, Romance] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4 | 5 | Father of the Bride Part II | [Comedy] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
5 rows × 24 columns
ratings_df.head()| userId | movieId | rating | timestamp | |
|---|---|---|---|---|
| 0 | 1 | 169 | 2.5 | 1204927694 |
| 1 | 1 | 2471 | 3.0 | 1204927438 |
| 2 | 1 | 48516 | 5.0 | 1204927435 |
| 3 | 2 | 2571 | 3.5 | 1436165433 |
| 4 | 2 | 109487 | 4.0 | 1436165496 |
ratings_df = ratings_df.drop('timestamp', 1)
ratings_df.head()| userId | movieId | rating | |
|---|---|---|---|
| 0 | 1 | 169 | 2.5 |
| 1 | 1 | 2471 | 3.0 |
| 2 | 1 | 48516 | 5.0 |
| 3 | 2 | 2571 | 3.5 |
| 4 | 2 | 109487 | 4.0 |
User Interests
user_movies = pd.DataFrame([
{'title':'Breakfast Club, The', 'rating':5},
{'title':'Toy Story', 'rating':3.5},
{'title':'Jumanji', 'rating':2},
{'title':"Pulp Fiction", 'rating':5},
{'title':'Akira', 'rating':4.5}
])
user_movies| rating | title | |
|---|---|---|
| 0 | 5.0 | Breakfast Club, The |
| 1 | 3.5 | Toy Story |
| 2 | 2.0 | Jumanji |
| 3 | 5.0 | Pulp Fiction |
| 4 | 4.5 | Akira |
movie_ids = genres_df[genres_df['title'].isin(user_movies['title'].tolist())]
user_movies = pd.merge(movie_ids, user_movies)
user_genres = user_movies.drop('genres', 1).drop('year',1)
user_genres| movieId | title | Adventure | Animation | Children | Comedy | Fantasy | Romance | Drama | Action | ... | Mystery | Sci-Fi | IMAX | Documentary | War | Musical | Western | Film-Noir | (no genres listed) | rating | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1 | Toy Story | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 3.5 |
| 1 | 2 | Jumanji | 1.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 2.0 |
| 2 | 296 | Pulp Fiction | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 5.0 |
| 3 | 1274 | Akira | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 1.0 | ... | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 4.5 |
| 4 | 1968 | Breakfast Club, The | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 5.0 |
5 rows × 23 columns
Since we only need the genres
user_genres.drop('title', 1, inplace=True)
user_genres.drop('movieId', 1, inplace=True)
user_genres.drop('rating', 1, inplace=True)
user_genres| Adventure | Animation | Children | Comedy | Fantasy | Romance | Drama | Action | Crime | Thriller | Horror | Mystery | Sci-Fi | IMAX | Documentary | War | Musical | Western | Film-Noir | (no genres listed) | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 0 | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1 | 1.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
And next we need to multiply this with the ratings column
user_profile = user_genres.transpose().dot(user_movies['rating'])
user_profileAdventure 10.0 Animation 8.0 Children 5.5 Comedy 13.5 Fantasy 5.5 Romance 0.0 Drama 10.0 Action 4.5 Crime 5.0 Thriller 5.0 Horror 0.0 Mystery 0.0 Sci-Fi 4.5 IMAX 0.0 Documentary 0.0 War 0.0 Musical 0.0 Western 0.0 Film-Noir 0.0 (no genres listed) 0.0 dtype: float64
We can then compare this to the table of all our movies, and build a recommendation based on that
all_genres = genres_df.set_index(genres_df['movieId'])
all_genres.head()| movieId | title | genres | year | Adventure | Animation | Children | Comedy | Fantasy | Romance | ... | Horror | Mystery | Sci-Fi | IMAX | Documentary | War | Musical | Western | Film-Noir | (no genres listed) | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| movieId | |||||||||||||||||||||
| 1 | 1 | Toy Story | [Adventure, Animation, Children, Comedy, Fantasy] | 1995 | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2 | 2 | Jumanji | [Adventure, Children, Fantasy] | 1995 | 1.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3 | 3 | Grumpier Old Men | [Comedy, Romance] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4 | 4 | Waiting to Exhale | [Comedy, Drama, Romance] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5 | 5 | Father of the Bride Part II | [Comedy] | 1995 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | ... | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
5 rows × 24 columns
all_genres.drop(['movieId','title','genres','year'], 1, inplace=True)
all_genres.head()| Adventure | Animation | Children | Comedy | Fantasy | Romance | Drama | Action | Crime | Thriller | Horror | Mystery | Sci-Fi | IMAX | Documentary | War | Musical | Western | Film-Noir | (no genres listed) | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| movieId | ||||||||||||||||||||
| 1 | 1.0 | 1.0 | 1.0 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2 | 1.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 1.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5 | 0.0 | 0.0 | 0.0 | 1.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
user_recommendation = all_genres.dot(user_profile)/user_profile.sum()
user_recommendation.head()movieId 1 0.594406 2 0.293706 3 0.188811 4 0.328671 5 0.188811 dtype: float64
user_recommendation.sort_values(ascending=False, inplace=True)
user_recommendation.head(10)movieId 5018 0.748252 26093 0.734266 27344 0.720280 148775 0.685315 6902 0.678322 117646 0.678322 64645 0.671329 81132 0.671329 122787 0.671329 2987 0.664336 dtype: float64
Top Recommendations for User
movies_df.loc[movies_df['movieId'].isin(user_recommendation.head().keys())]| movieId | title | genres | year | |
|---|---|---|---|---|
| 4923 | 5018 | Motorama | [Adventure, Comedy, Crime, Drama, Fantasy, Mys... | 1991 |
| 6793 | 6902 | Interstate 60 | [Adventure, Comedy, Drama, Fantasy, Mystery, S... | 2002 |
| 8605 | 26093 | Wonderful World of the Brothers Grimm, The | [Adventure, Animation, Children, Comedy, Drama... | 1962 |
| 9296 | 27344 | Revolutionary Girl Utena: Adolescence of Utena... | [Action, Adventure, Animation, Comedy, Drama, ... | 1999 |
| 33509 | 148775 | Wizards of Waverly Place: The Movie | [Adventure, Children, Comedy, Drama, Fantasy, ... | 2009 |
Collaborative Filtering
Collaborative filtering works by recommending content based on other similar users/items
There are two types
- User
- Based on user's similar neighborhood
- Item
- Based on similarity of item recommendations
Lab
Note that this uses the same movie data as before and uses the Pearson Correlation Coefficient to identify users who rate movies similarly based on the ratings table and can be found in 5-2-Collaborative-Filtering